5-EtO-DET
2-(5-Ethoxy-1H-indol-3-yl)-N,N-diethylethan-1-amine
 5585  C16H24N2O  260.375
 InChI=1S/C16H24N2O/c1-4-18(5-2)10-9-13-12-17-16-8-7-14(19-6-3)11-15(13)16/h7-8,11-12,17H,4-6,9-10H2,1-3H3
 XYGNVSLHDPYYFX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccc2c(c1)c(CCN(CC)CC)c[nH]2