5-MeO-2-Me-EPT
N-Ethyl-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]propan-1-amine
 5581  C17H26N2O  274.401
 InChI=1S/C17H26N2O/c1-5-10-19(6-2)11-9-15-13(3)18-17-8-7-14(20-4)12-16(15)17/h7-8,12,18H,5-6,9-11H2,1-4H3
 VLKQAXHAXKFIGX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(CCc1c(C)[nH]c2c1cc(OC)cc2)CC