5-MeO-2-Me-EIPT
N-Ethyl-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]propan-2-amine
 5579  C17H26N2O  274.401
 InChI=1S/C17H26N2O/c1-6-19(12(2)3)10-9-15-13(4)18-17-8-7-14(20-5)11-16(15)17/h7-8,11-12,18H,6,9-10H2,1-5H3
 HNAFTRUGXTWVHI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(C(C)C)CCc1c(C)[nH]c2c1cc(OC)cc2