5-MeO-2-Me-MPT
N-[2-(5-Methoxy-2-methyl-1H-indol-3-yl)ethyl]-N-methylpropan-2-amine
 5578  C16H24N2O  260.375
 InChI=1S/C16H24N2O/c1-11(2)18(4)9-8-14-12(3)17-16-7-6-13(19-5)10-15(14)16/h6-7,10-11,17H,8-9H2,1-5H3
 MHKXMSLXCHKLCM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)c(CCN(C(C)C)C)c([nH]2)C