5-MeO-2-Me-MIPT
N-[2-(5-Methoxy-2-methyl-1H-indol-3-yl)ethyl]-N-methylpropan-1-amine
 5577  C16H24N2O  260.375
 InChI=1S/C16H24N2O/c1-5-9-18(3)10-8-14-12(2)17-16-7-6-13(19-4)11-15(14)16/h6-7,11,17H,5,8-10H2,1-4H3
 UVKOBGODXAQEIG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(CCc1c(C)[nH]c2c1cc(OC)cc2)C