5-MeO-2-Me-DIPT
N-[2-(5-Methoxy-2-methyl-1H-indol-3-yl)ethyl]-N-(propan-2-yl)propan-2-amine
 5575  C18H28N2O  288.428
 InChI=1S/C18H28N2O/c1-12(2)20(13(3)4)10-9-16-14(5)19-18-8-7-15(21-6)11-17(16)18/h7-8,11-13,19H,9-10H2,1-6H3
 FIYFFTLAGBZDFW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)c(CCN(C(C)C)C(C)C)c([nH]2)C