5-MeO-2-Me-DPT
N-[2-(5-Methoxy-2-methyl-1H-indol-3-yl)ethyl]-N-propylpropan-1-amine
 5574  C18H28N2O  288.428
 InChI=1S/C18H28N2O/c1-5-10-20(11-6-2)12-9-16-14(3)19-18-8-7-15(21-4)13-17(16)18/h7-8,13,19H,5-6,9-12H2,1-4H3
 KUJSUSZXSLQFQL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(CCc1c(C)[nH]c2c1cc(OC)cc2)CCC