5-MeO-2-Me-DET
N,N-Diethyl-2-(5-methoxy-2-methyl-1H-indol-3-yl)ethan-1-amine
 5573  C16H24N2O  260.375
 InChI=1S/C16H24N2O/c1-5-18(6-2)10-9-14-12(3)17-16-8-7-13(19-4)11-15(14)16/h7-8,11,17H,5-6,9-10H2,1-4H3
 IABQAKLBSGLIHM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(CCc1c(C)[nH]c2c1cc(OC)cc2)CC