β,2-Dihydroxy-N-methylphenethylamine
2-[1-Hydroxy-2-(methylamino)ethyl]phenol
 5548 C9H13NO2 167.205
 InChI=1S/C9H13NO2/c1-10-6-9(12)7-4-2-3-5-8(7)11/h2-5,9-12H,6H2,1H3
 YVGQHEIZCSVQHE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCC(c1ccccc1O)O