5-EtO-T
2-(5-Ethoxy-1H-indol-3-yl)ethan-1-amine
 5478  C12H16N2O  204.268
 InChI=1S/C12H16N2O/c1-2-15-10-3-4-12-11(7-10)9(5-6-13)8-14-12/h3-4,7-8,14H,2,5-6,13H2,1H3
 HWNPGCPKNYFXMA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c[nH]c2c1cc(OCC)cc2