DSBT
N-(Butan-2-yl)-N-[2-(1H-indol-3-yl)ethyl]butan-2-amine
 5476  C18H28N2  272.428
 InChI=1S/C18H28N2/c1-5-14(3)20(15(4)6-2)12-11-16-13-19-18-10-8-7-9-17(16)18/h7-10,13-15,19H,5-6,11-12H2,1-4H3
 GAMSOQVPHIMBSR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(N(C(CC)C)CCc1c[nH]c2c1cccc2)C