MSBT
N-[2-(1H-Indol-3-yl)ethyl]-N-methylbutan-2-amine
 5475  C15H22N2  230.349
 InChI=1S/C15H22N2/c1-4-12(2)17(3)10-9-13-11-16-15-8-6-5-7-14(13)15/h5-8,11-12,16H,4,9-10H2,1-3H3
 JFDFFCIYMLHPFQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(N(CCc1c[nH]c2c1cccc2)C)C