5-MeO-N-Me-IPYR
5-Methoxy-3-(1-methylpyrrolidin-3-yl)-1H-indole
 5472  C14H18N2O  230.306
 InChI=1S/C14H18N2O/c1-16-6-5-10(9-16)13-8-15-14-4-3-11(17-2)7-12(13)14/h3-4,7-8,10,15H,5-6,9H2,1-2H3
 ISLZNKXLIRVSJS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)c(c[nH]2)C1CCN(C1)C