4-HO-N-Me-IPYR
3-(1-Methylpyrrolidin-3-yl)-1H-indol-4-ol
 5471  C13H16N2O  216.279
 InChI=1S/C13H16N2O/c1-15-6-5-9(8-15)10-7-14-11-3-2-4-12(16)13(10)11/h2-4,7,9,14,16H,5-6,8H2,1H3
 DZKMCQNELDTDGP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN1CCC(C1)c1c[nH]c2c1c(O)ccc2