5-HO-DPT
3-[2-(Dipropylamino)ethyl]-1H-indol-5-ol
 5465  C16H24N2O  260.375
 InChI=1S/C16H24N2O/c1-3-8-18(9-4-2)10-7-13-12-17-16-6-5-14(19)11-15(13)16/h5-6,11-12,17,19H,3-4,7-10H2,1-2H3
 CWMOGUBWVJQDSL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(CCC)CCc1c[nH]c2c1cc(O)cc2