5-MeO-MIBT
N-[2-(5-Methoxy-1H-indol-3-yl)ethyl]-N,2-dimethylpropan-1-amine
 5464  C16H24N2O  260.375
 InChI=1S/C16H24N2O/c1-12(2)11-18(3)8-7-13-10-17-16-6-5-14(19-4)9-15(13)16/h5-6,9-10,12,17H,7-8,11H2,1-4H3
 POLLXYVGPPSRQX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)c(CCN(CC(C)C)C)c[nH]2