MIBT
N-[2-(1H-Indol-3-yl)ethyl]-N,2-dimethylpropan-1-amine
 5463  C15H22N2  230.349
 InChI=1S/C15H22N2/c1-12(2)11-17(3)9-8-13-10-16-15-7-5-4-6-14(13)15/h4-7,10,12,16H,8-9,11H2,1-3H3
 SOTPLIRCHUNUNF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(CN(CCc1c[nH]c2c1cccc2)C)C