7-Pe-AMT
1-(1-Methyl-7-pentyl-1H-indol-3-yl)propan-2-amine
 5457  C17H26N2  258.402
 InChI=1S/C17H26N2/c1-4-5-6-8-14-9-7-10-16-15(11-13(2)18)12-19(3)17(14)16/h7,9-10,12-13H,4-6,8,11,18H2,1-3H3
 ZKKUYEBEARXPJS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCc1cccc2c1n(C)cc2CC(N)C