1-Pe-AMT
1-(1-Pentyl-1H-indol-3-yl)propan-2-amine
 5455  C16H24N2  244.375
 InChI=1S/C16H24N2/c1-3-4-7-10-18-12-14(11-13(2)17)15-8-5-6-9-16(15)18/h5-6,8-9,12-13H,3-4,7,10-11,17H2,1-2H3
 VDFRLZYVYBOBOD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCn1cc(c2c1cccc2)CC(N)C