1-Pr-AMT
1-(1-Propyl-1H-indol-3-yl)propan-2-amine
 5454  C14H20N2  216.322
 InChI=1S/C14H20N2/c1-3-8-16-10-12(9-11(2)15)13-6-4-5-7-14(13)16/h4-7,10-11H,3,8-9,15H2,1-2H3
 YISGDWSLBBTJAE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCn1cc(c2c1cccc2)CC(N)C