2-Butoxy-5-methoxy-4-methylamphetamine
1-(2-Butoxy-5-methoxy-4-methylphenyl)propan-2-amine
 535 C15H25NO2 251.365
 InChI=1S/C15H25NO2/c1-5-6-7-18-15-8-11(2)14(17-4)10-13(15)9-12(3)16/h8,10,12H,5-7,9,16H2,1-4H3
 MPJPVSLBYCXXFX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCOc1cc(C)c(cc1CC(N)C)OC