2-Ethoxy-4-ethyl-5-methoxyamphetamine
1-(2-Ethoxy-4-ethyl-5-methoxyphenyl)propan-2-amine
 532 C14H23NO2 237.338
 InChI=1S/C14H23NO2/c1-5-11-8-14(17-6-2)12(7-10(3)15)9-13(11)16-4/h8-10H,5-7,15H2,1-4H3
 BUQOPIQJYPMXLL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(CC)c(cc1CC(N)C)OC