2,6-Diethoxy-4-ethylamphetamine
1-(2,6-Diethoxy-4-ethylphenyl)propan-2-amine
 529 C15H25NO2 251.365
 InChI=1S/C15H25NO2/c1-5-12-9-14(17-6-2)13(8-11(4)16)15(10-12)18-7-3/h9-11H,5-8,16H2,1-4H3
 OFHJNRIDXYGFBW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(CC)cc(c1CC(N)C)OCC