4-Methyl-2,6-dipropoxyamphetamine
1-(4-Methyl-2,6-dipropoxyphenyl)propan-2-amine
 527 C16H27NO2 265.391
 InChI=1S/C16H27NO2/c1-5-7-18-15-9-12(3)10-16(19-8-6-2)14(15)11-13(4)17/h9-10,13H,5-8,11,17H2,1-4H3
 OYHUCFDLMKDBSX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCOc1cc(C)cc(c1CC(N)C)OCCC