5-Formylpsilocin
3-[2-(Dimethylamino)ethyl]-4-hydroxy-1H-indole-5-carbaldehyde
 5238  C13H16N2O2  232.278
 InChI=1S/C13H16N2O2/c1-15(2)6-5-9-7-14-11-4-3-10(8-16)13(17)12(9)11/h3-4,7-8,14,17H,5-6H2,1-2H3
 NTUKYESCAWZODK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=Cc1ccc2c(c1O)c(CCN(C)C)c[nH]2