α-Methylpsilocin
3-[2-(Dimethylamino)propyl]-1H-indol-4-ol
 5237  C13H18N2O  218.295
 InChI=1S/C13H18N2O/c1-9(15(2)3)7-10-8-14-11-5-4-6-12(16)13(10)11/h4-6,8-9,14,16H,7H2,1-3H3
 GRWDWEFPYLWISL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C(Cc1c[nH]c2c1c(O)ccc2)C)C