2-Methylpsilocin
3-[2-(Dimethylamino)ethyl]-2-methyl-1H-indol-4-ol
 5236  C13H18N2O  218.295
 InChI=1S/C13H18N2O/c1-9-10(7-8-15(2)3)13-11(14-9)5-4-6-12(13)16/h4-6,14,16H,7-8H2,1-3H3
 HXNGZUVNHQYMKL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1c(C)[nH]c2c1c(O)ccc2)C