4,5-DHP-T
2-(3,7,8,9-Tetrahydropyrano[3,2-e]indol-1-yl)ethan-1-amine
 5215  C13H16N2O  216.279
 InChI=1S/C13H16N2O/c14-6-5-9-8-15-11-3-4-12-10(13(9)11)2-1-7-16-12/h3-4,8,15H,1-2,5-7,14H2
 CRBUBLCOTKWRPR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c[nH]c2c1c1CCCOc1cc2