N,N-Dimethyl-2-(1,6,7,8-tetrahydropyrano[2,3-f]indol-3-yl)ethan-1-amine
 5213  C15H20N2O  244.332
 InChI=1S/C15H20N2O/c1-17(2)6-5-12-10-16-14-8-11-4-3-7-18-15(11)9-13(12)14/h8-10,16H,3-7H2,1-2H3
 JLWIAKOXJGKMDU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1c[nH]c2c1cc1OCCCc1c2)C