4-HO-CPDPA
4-[2-(Dipropylamino)cyclopropyl]phenol
 517 C15H23NO 233.349
 InChI=1S/C15H23NO/c1-3-9-16(10-4-2)15-11-14(15)12-5-7-13(17)8-6-12/h5-8,14-15,17H,3-4,9-11H2,1-2H3
 KYYDOJVIXFOGOC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(C1CC1c1ccc(cc1)O)CCC