3-HO-CPDPA
3-[2-(Dipropylamino)cyclopropyl]phenol
 515 C15H23NO 233.349
 InChI=1S/C15H23NO/c1-3-8-16(9-4-2)15-11-14(15)12-6-5-7-13(17)10-12/h5-7,10,14-15,17H,3-4,8-9,11H2,1-2H3
 SGAIAYHFAITRSL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(C1CC1c1cccc(c1)O)CCC