2-HO-CPDPA
2-[2-(Dipropylamino)cyclopropyl]phenol
 509 C15H23NO 233.349
 InChI=1S/C15H23NO/c1-3-9-16(10-4-2)14-11-13(14)12-7-5-6-8-15(12)17/h5-8,13-14,17H,3-4,9-11H2,1-2H3
 LARFBOKVMNMLSW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(C1CC1c1ccccc1O)CCC