5-CHPr-2-MPEA
2-[5-(3-Cyclohexylpropyl)-2-methoxyphenyl]ethan-1-amine
 493 C18H29NO 275.429
 InChI=1S/C18H29NO/c1-20-18-11-10-16(14-17(18)12-13-19)9-5-8-15-6-3-2-4-7-15/h10-11,14-15H,2-9,12-13,19H2,1H3
 BPPADXBXONCLQT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(CCCC2CCCCC2)ccc1OC