ψ-2C-DFE
2-[4-(2,2-Difluoroethyl)-2,6-dimethoxyphenyl]ethan-1-amine
 480  C12H17F2NO2  245.266
 InChI=1S/C12H17F2NO2/c1-16-10-5-8(7-12(13)14)6-11(17-2)9(10)3-4-15/h5-6,12H,3-4,7,15H2,1-2H3
 KNPDYDCQWCSZFA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(OC)cc(cc1OC)CC(F)F