ψ-2C-O-21
2-[4-(2-Fluoroethoxy)-2,6-dimethoxyphenyl]ethan-1-amine
 474  C12H18FNO3  243.275
 InChI=1S/C12H18FNO3/c1-15-11-7-9(17-6-4-13)8-12(16-2)10(11)3-5-14/h7-8H,3-6,14H2,1-2H3
 WGLJFOJNFHJPLN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(OC)cc(cc1OC)OCCF