MPMI
3-[(1-Methylpyrrolidin-2-yl)methyl]-1H-indole
 4369  C14H18N2  214.306
 InChI=1S/C14H18N2/c1-16-8-4-5-12(16)9-11-10-15-14-7-3-2-6-13(11)14/h2-3,6-7,10,12,15H,4-5,8-9H2,1H3
 HCTCDEAMCNSARD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN1CCCC1Cc1c[nH]c2c1cccc2