5MT-NB4NH2
4-({[2-(5-Methoxy-1H-indol-3-yl)ethyl]amino}methyl)aniline
 435  C18H21N3O  295.379
 InChI=1S/C18H21N3O/c1-22-16-6-7-18-17(10-16)14(12-21-18)8-9-20-11-13-2-4-15(19)5-3-13/h2-7,10,12,20-21H,8-9,11,19H2,1H3
 IFVUNWPYBPIEIO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)c(CCNCc1ccc(cc1)N)c[nH]2