2-(4-Fluorophenyl)piperazine
2-(4-Fluorophenyl)piperazine
 3944  C10H13FN2  180.222
 InChI=1S/C10H13FN2/c11-9-3-1-8(2-4-9)10-7-12-5-6-13-10/h1-4,10,12-13H,5-7H2
 NZAKSEMIIIZYEM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Fc1ccc(cc1)C1NCCNC1