4-Phenyl U-51754
rel-2-([1,1′-Biphenyl]-4-yl)-N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-N-methylacetamide
 3928 C23H30N2O 350.497
 InChI=1S/C23H30N2O/c1-24(2)21-11-7-8-12-22(21)25(3)23(26)17-18-13-15-20(16-14-18)19-9-5-4-6-10-19/h4-6,9-10,13-16,21-22H,7-8,11-12,17H2,1-3H3/t21-,22-/m1/s1
 JMDIMUCMZWADSC-FGZHOGPDSA-N This stereoisomer Any stereoisomer
 CN([C@@H]1CCCC[C@H]1N(C(=O)Cc1ccc(cc1)c1ccccc1)C)C