5F-ethylbenzyl-PICA
1-(5-Fluoropentyl)-N-(1-phenylpropyl)-1H-indole-3-carboxamide
 3899 C23H27FN2O 366.472
 Cannabinoid
 InChI=1S/C23H27FN2O/c1-2-21(18-11-5-3-6-12-18)25-23(27)20-17-26(16-10-4-9-15-24)22-14-8-7-13-19(20)22/h3,5-8,11-14,17,21H,2,4,9-10,15-16H2,1H3,(H,25,27)
 YLKKXELHYJFYLY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 FCCCCCn1cc(c2c1cccc2)C(=O)NC(c1ccccc1)CC