Norecgonidine methyl ester
Methyl 8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate
 3868 C9H13NO2 167.205
 InChI=1S/C9H13NO2/c1-12-9(11)7-4-2-6-3-5-8(7)10-6/h4,6,8,10H,2-3,5H2,1H3
 DJXUOKXQNIBCET-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COC(=O)C1=CCC2NC1CC2