Ciproxifan
Cyclopropyl{4-[3-(1H-imidazol-4-yl)propoxy]phenyl}methanone
 3677 C16H18N2O2 270.326
 InChI=1S/C16H18N2O2/c19-16(12-3-4-12)13-5-7-15(8-6-13)20-9-1-2-14-10-17-11-18-14/h5-8,10-12H,1-4,9H2,(H,17,18)
 ACQBHJXEAYTHCY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C(c1ccc(cc1)OCCCc1nc[nH]c1)C1CC1