3-MeO-CPDBA
N,N-Dibutyl-2-(3-methoxyphenyl)cyclopropan-1-amine
 3620 C18H29NO 275.429
 InChI=1S/C18H29NO/c1-4-6-11-19(12-7-5-2)18-14-17(18)15-9-8-10-16(13-15)20-3/h8-10,13,17-18H,4-7,11-12,14H2,1-3H3
 IGZGCGSTUXUNOX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCN(C1CC1c1cccc(c1)OC)CCCC