3-MeO-CPDEA
N,N-Diethyl-2-(3-methoxyphenyl)cyclopropan-1-amine
 3619 C14H21NO 219.323
 InChI=1S/C14H21NO/c1-4-15(5-2)14-10-13(14)11-7-6-8-12(9-11)16-3/h6-9,13-14H,4-5,10H2,1-3H3
 GWWGKYJLUQVEBT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(C1CC1c1cccc(c1)OC)CC