3-MeO-CPA
2-(3-Methoxyphenyl)cyclopropan-1-amine
 3617 C10H13NO 163.216
 InChI=1S/C10H13NO/c1-12-8-4-2-3-7(5-8)9-6-10(9)11/h2-5,9-10H,6,11H2,1H3
 DRLVWPIMRZBCNJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cccc(c1)C1CC1N