2-MeO-CPDBA
N,N-Dibutyl-2-(2-methoxyphenyl)cyclopropan-1-amine
 3615 C18H29NO 275.429
 InChI=1S/C18H29NO/c1-4-6-12-19(13-7-5-2)17-14-16(17)15-10-8-9-11-18(15)20-3/h8-11,16-17H,4-7,12-14H2,1-3H3
 NGINRPTUUGKDJU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCN(C1CC1c1ccccc1OC)CCCC