2-MeO-CPDEA
N,N-Diethyl-2-(2-methoxyphenyl)cyclopropan-1-amine
 3614 C14H21NO 219.323
 InChI=1S/C14H21NO/c1-4-15(5-2)13-10-12(13)11-8-6-7-9-14(11)16-3/h6-9,12-13H,4-5,10H2,1-3H3
 IKDUUOZAISTNIA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(C1CC1c1ccccc1OC)CC