2-MeO-CPA
2-(2-Methoxyphenyl)cyclopropan-1-amine
 3612 C10H13NO 163.216
 InChI=1S/C10H13NO/c1-12-10-5-3-2-4-7(10)8-6-9(8)11/h2-5,8-9H,6,11H2,1H3
 DHHVOLWFZZZOCA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccccc1C1CC1N