3,4-Methylenedioxy-2-N,N-dipropylindan
N,N-Dipropyl-6,7-dihydro-2H,5H-indeno[5,6-d][1,3]dioxol-6-amine
 3601 C16H23NO2 261.359
 InChI=1S/C16H23NO2/c1-3-5-17(6-4-2)14-7-12-9-15-16(19-11-18-15)10-13(12)8-14/h9-10,14H,3-8,11H2,1-2H3
 UEFRSRIXKRCUJJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(C1Cc2c(C1)cc1c(c2)OCO1)CCC