N-Benzyltyramine
4-[2-(Benzylamino)ethyl]phenol
 3593  C15H17NO  227.302
 InChI=1S/C15H17NO/c17-15-8-6-13(7-9-15)10-11-16-12-14-4-2-1-3-5-14/h1-9,16-17H,10-12H2
 DAKFPYXAXDNNMV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Oc1ccc(cc1)CCNCc1ccccc1